Is there a way to use the chemical transformation node to serially process one match at a time instead of serially applying the transformation multiple times for the same starting molecule?
For example, consider this SMARTS:
[N;H1;X3:1]>>[N;X3:1][N]=O
to turn secondary amines into N-nitrosamines.
One of the input structures is this
CC1=C([C@H](c2ccccc2[N+](=O)[O-])N[C@H](c3ccccc3[N+](=O)[O-])N1)C(=O)OC
Which has 2 matching secondary amines.
As far as I can tell, the RDKit Chemical Transformation node gives you the option of getting either a single mono-nitrosamine or the dinitrosamine.
Is there a way to get both mono-nitrosamines?
